C25H27N3O4S2 — CID 43946236
4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(4-methoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43946236) has the molecular formula C25H27N3O4S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(4-methoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(4-methoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43946236 |
| Molecular Formula | C25H27N3O4S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(4-methoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CC(C)CC(C)C3)cc2)sc2cccc(OC)c21 |
| InChI | InChI=1S/C25H27N3O4S2/c1-5-13-28-23-21(32-4)7-6-8-22(23)33-25(28)26-24(29)19-9-11-20(12-10-19)34(30,31)27-15-17(2)14-18(3)16-27/h1,6-12,17-18H,13-16H2,2-4H3/b26-25- |
| InChIKey | ASETUAKFOYOHDU-QPLCGJKRSA-N |
| XLogP | 3.75 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|