C21H20N4O7S2 — CID 43983606
ethyl 3-[2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate (PubChem CID 43983606) has the molecular formula C21H20N4O7S2 and a molecular weight of 504.55 g/mol. Its IUPAC name is ethyl 3-[2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate.
| Compound Name | ethyl 3-[2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate |
|---|---|
| PubChem CID | 43983606 |
| Molecular Formula | C21H20N4O7S2 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | ethyl 3-[2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate |
| SMILES | CCOC(=O)CCn1/c(=N/C(=O)/C=C/c2cccc([N+](=O)[O-])c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H20N4O7S2/c1-2-32-20(27)10-11-24-17-8-7-16(34(22,30)31)13-18(17)33-21(24)23-19(26)9-6-14-4-3-5-15(12-14)25(28)29/h3-9,12-13H,2,10-11H2,1H3,(H2,22,30,31)/b9-6+,23-21- |
| InChIKey | SBRMMHDPRGXXTP-REWNPNNESA-N |
| XLogP | 2.35 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|