C22H21N3O6S — CID 40999177
methyl 3-(2-ethoxyethyl)-2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazole-6-carboxylate (PubChem CID 40999177) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is methyl 3-(2-ethoxyethyl)-2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-(2-ethoxyethyl)-2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 40999177 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | methyl 3-(2-ethoxyethyl)-2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)/C=C/c2cccc([N+](=O)[O-])c2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C22H21N3O6S/c1-3-31-12-11-24-18-9-8-16(21(27)30-2)14-19(18)32-22(24)23-20(26)10-7-15-5-4-6-17(13-15)25(28)29/h4-10,13-14H,3,11-12H2,1-2H3/b10-7+,23-22- |
| InChIKey | GARPZLHFSYMZQP-RXABSQTOSA-N |
| XLogP | 3.57 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|