C25H28N2O7S — CID 43937343
methyl 3-(2-ethoxyethyl)-2-[(Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]imino-1,3-benzothiazole-6-carboxylate (PubChem CID 43937343) has the molecular formula C25H28N2O7S and a molecular weight of 500.57 g/mol. Its IUPAC name is methyl 3-(2-ethoxyethyl)-2-[(Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-(2-ethoxyethyl)-2-[(Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 43937343 |
| Molecular Formula | C25H28N2O7S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | methyl 3-(2-ethoxyethyl)-2-[(Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)/C=C\c2cc(OC)c(OC)c(OC)c2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C25H28N2O7S/c1-6-34-12-11-27-18-9-8-17(24(29)33-5)15-21(18)35-25(27)26-22(28)10-7-16-13-19(30-2)23(32-4)20(14-16)31-3/h7-10,13-15H,6,11-12H2,1-5H3/b10-7-,26-25- |
| InChIKey | XZJLNDKJHTVLQP-DJIRSJFPSA-N |
| XLogP | 3.69 |
| TPSA | 97.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|