C22H19N3O6S — CID 43945123
(Z)-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 43945123) has the molecular formula C22H19N3O6S and a molecular weight of 453.48 g/mol. Its IUPAC name is (Z)-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43945123 |
| Molecular Formula | C22H19N3O6S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | (Z)-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | C#CCn1/c(=N/C(=O)/C=C\c2cc(OC)c(OC)c(OC)c2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C22H19N3O6S/c1-5-10-24-16-8-7-15(25(27)28)13-19(16)32-22(24)23-20(26)9-6-14-11-17(29-2)21(31-4)18(12-14)30-3/h1,6-9,11-13H,10H2,2-4H3/b9-6-,23-22- |
| InChIKey | PNCCJIQWESCURA-HOTBLYKUSA-N |
| XLogP | 3.41 |
| TPSA | 105.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|