C19H14ClN3O5S — CID 40951585
2-chloro-N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-5-nitrobenzamide (PubChem CID 40951585) has the molecular formula C19H14ClN3O5S and a molecular weight of 431.86 g/mol. Its IUPAC name is 2-chloro-N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-5-nitrobenzamide.
| Compound Name | 2-chloro-N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-5-nitrobenzamide |
|---|---|
| PubChem CID | 40951585 |
| Molecular Formula | C19H14ClN3O5S |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 2-chloro-N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-5-nitrobenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc([N+](=O)[O-])ccc2Cl)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H14ClN3O5S/c1-4-7-22-14-9-15(27-2)16(28-3)10-17(14)29-19(22)21-18(24)12-8-11(23(25)26)5-6-13(12)20/h1,5-6,8-10H,7H2,2-3H3/b21-19- |
| InChIKey | GUHHQRXQYFYBLM-VZCXRCSSSA-N |
| XLogP | 3.66 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|