C26H27N3O7S2 — CID 3578125
ethyl 2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-3-(2-methoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 3578125) has the molecular formula C26H27N3O7S2 and a molecular weight of 557.65 g/mol. Its IUPAC name is ethyl 2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-3-(2-methoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-3-(2-methoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3578125 |
| Molecular Formula | C26H27N3O7S2 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | ethyl 2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-3-(2-methoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc(C(=O)OCC)ccc3n2CC(=O)OC)cc1 |
| InChI | InChI=1S/C26H27N3O7S2/c1-5-14-28(15-6-2)38(33,34)20-11-8-18(9-12-20)24(31)27-26-29(17-23(30)35-4)21-13-10-19(16-22(21)37-26)25(32)36-7-3/h5-6,8-13,16H,1-2,7,14-15,17H2,3-4H3/b27-26- |
| InChIKey | HZBXCRZUSLJIJO-RQZHXJHFSA-N |
| XLogP | 3.16 |
| TPSA | 124.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|