C26H27N3O5S2 — CID 40886670
N-[3-(2-ethoxyethyl)-4-methoxy-1,3-benzothiazol-2-ylidene]-2-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 40886670) has the molecular formula C26H27N3O5S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4-methoxy-1,3-benzothiazol-2-ylidene]-2-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4-methoxy-1,3-benzothiazol-2-ylidene]-2-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 40886670 |
| Molecular Formula | C26H27N3O5S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4-methoxy-1,3-benzothiazol-2-ylidene]-2-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccccc2NS(=O)(=O)c2ccc(C)cc2)sc2cccc(OC)c21 |
| InChI | InChI=1S/C26H27N3O5S2/c1-4-34-17-16-29-24-22(33-3)10-7-11-23(24)35-26(29)27-25(30)20-8-5-6-9-21(20)28-36(31,32)19-14-12-18(2)13-15-19/h5-15,28H,4,16-17H2,1-3H3/b27-26- |
| InChIKey | VELXCNUTRXGKST-RQZHXJHFSA-N |
| XLogP | 4.60 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|