C27H29N3O5S2 — CID 43979952
N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-2-[(4-methoxyphenyl)sulfonylamino]benzamide (PubChem CID 43979952) has the molecular formula C27H29N3O5S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-2-[(4-methoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-2-[(4-methoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 43979952 |
| Molecular Formula | C27H29N3O5S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-2-[(4-methoxyphenyl)sulfonylamino]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccccc2NS(=O)(=O)c2ccc(OC)cc2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C27H29N3O5S2/c1-5-35-15-14-30-24-16-18(2)19(3)17-25(24)36-27(30)28-26(31)22-8-6-7-9-23(22)29-37(32,33)21-12-10-20(34-4)11-13-21/h6-13,16-17,29H,5,14-15H2,1-4H3/b28-27- |
| InChIKey | XSJXGFTUXPPLJJ-DQSJHHFOSA-N |
| XLogP | 4.91 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|