C23H24N4O8S2 — CID 16851411
methyl 2-[2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoyl]imino-5-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 16851411) has the molecular formula C23H24N4O8S2 and a molecular weight of 548.60 g/mol. Its IUPAC name is methyl 2-[2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoyl]imino-5-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoyl]imino-5-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16851411 |
| Molecular Formula | C23H24N4O8S2 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | methyl 2-[2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoyl]imino-5-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CC(C)OC(C)C3)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C23H24N4O8S2/c1-14-11-25(12-15(2)35-14)37(32,33)18-7-4-16(5-8-18)22(29)24-23-26(13-21(28)34-3)19-10-17(27(30)31)6-9-20(19)36-23/h4-10,14-15H,11-13H2,1-3H3/b24-23- |
| InChIKey | YOTZYBYCHKMZQP-VHXPQNKSSA-N |
| XLogP | 2.32 |
| TPSA | 150.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|