C19H19N3O3S2 — CID 41125933
N-[5,7-dimethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide (PubChem CID 41125933) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[5,7-dimethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide.
| Compound Name | N-[5,7-dimethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide |
|---|---|
| PubChem CID | 41125933 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[5,7-dimethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide |
| SMILES | CSCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C19H19N3O3S2/c1-12-10-13(2)17-16(11-12)21(8-9-26-3)19(27-17)20-18(23)14-4-6-15(7-5-14)22(24)25/h4-7,10-11H,8-9H2,1-3H3/b20-19- |
| InChIKey | SPCDDLWHDYGUHY-VXPUYCOJSA-N |
| XLogP | 4.33 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|