C20H18Cl2N2O4S — CID 5178060
ethyl 2-[2-(2,4-dichlorobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 5178060) has the molecular formula C20H18Cl2N2O4S and a molecular weight of 453.35 g/mol. Its IUPAC name is ethyl 2-[2-(2,4-dichlorobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(2,4-dichlorobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 5178060 |
| Molecular Formula | C20H18Cl2N2O4S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | ethyl 2-[2-(2,4-dichlorobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccc(Cl)cc2Cl)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C20H18Cl2N2O4S/c1-3-27-13-6-8-16-17(10-13)29-20(24(16)11-18(25)28-4-2)23-19(26)14-7-5-12(21)9-15(14)22/h5-10H,3-4,11H2,1-2H3/b23-20- |
| InChIKey | SRDRPZYCDCAMDM-ATJXCDBQSA-N |
| XLogP | 4.71 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |