C18H12ClN3OS2 — CID 4574441
N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide (PubChem CID 4574441) has the molecular formula C18H12ClN3OS2 and a molecular weight of 385.90 g/mol. Its IUPAC name is N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 4574441 |
| Molecular Formula | C18H12ClN3OS2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc3ncsc3c2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H12ClN3OS2/c1-2-7-22-14-6-4-12(19)9-16(14)25-18(22)21-17(23)11-3-5-13-15(8-11)24-10-20-13/h2-6,8-10H,1,7H2/b21-18- |
| InChIKey | VRDFYZLINBSHQL-UZYVYHOESA-N |
| XLogP | 4.89 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|