C23H23N3O5S2 — CID 42388147
4-[bis(prop-2-enyl)sulfamoyl]-N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide (PubChem CID 42388147) has the molecular formula C23H23N3O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
|---|---|
| PubChem CID | 42388147 |
| Molecular Formula | C23H23N3O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc4c(cc3n2CC)OCO4)cc1 |
| InChI | InChI=1S/C23H23N3O5S2/c1-4-11-25(12-5-2)33(28,29)17-9-7-16(8-10-17)22(27)24-23-26(6-3)18-13-19-20(31-15-30-19)14-21(18)32-23/h4-5,7-10,13-14H,1-2,6,11-12,15H2,3H3/b24-23- |
| InChIKey | JGEVNXYKPFJAMX-VHXPQNKSSA-N |
| XLogP | 3.56 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|