C23H25FN2O5S2 — CID 25406481
ethyl 2-[2-[4-(4-fluorophenyl)sulfanylbutanoylimino]-4,7-dimethoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 25406481) has the molecular formula C23H25FN2O5S2 and a molecular weight of 492.59 g/mol. Its IUPAC name is ethyl 2-[2-[4-(4-fluorophenyl)sulfanylbutanoylimino]-4,7-dimethoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[4-(4-fluorophenyl)sulfanylbutanoylimino]-4,7-dimethoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 25406481 |
| Molecular Formula | C23H25FN2O5S2 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | ethyl 2-[2-[4-(4-fluorophenyl)sulfanylbutanoylimino]-4,7-dimethoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CCCSc2ccc(F)cc2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C23H25FN2O5S2/c1-4-31-20(28)14-26-21-17(29-2)11-12-18(30-3)22(21)33-23(26)25-19(27)6-5-13-32-16-9-7-15(24)8-10-16/h7-12H,4-6,13-14H2,1-3H3/b25-23- |
| InChIKey | NLCLTZATHWXLEV-BZZOAKBMSA-N |
| XLogP | 4.42 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|