C22H26N2O3S2 — CID 25406356
N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methoxyphenyl)sulfanylbutanamide (PubChem CID 25406356) has the molecular formula C22H26N2O3S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methoxyphenyl)sulfanylbutanamide.
| Compound Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methoxyphenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 25406356 |
| Molecular Formula | C22H26N2O3S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methoxyphenyl)sulfanylbutanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCCSc2ccc(OC)cc2)sc2ccccc21 |
| InChI | InChI=1S/C22H26N2O3S2/c1-3-27-15-14-24-19-7-4-5-8-20(19)29-22(24)23-21(25)9-6-16-28-18-12-10-17(26-2)11-13-18/h4-5,7-8,10-13H,3,6,9,14-16H2,1-2H3/b23-22- |
| InChIKey | OEOUCKCGQVQAHZ-FCQUAONHSA-N |
| XLogP | 4.75 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|