C19H17ClN2OS2 — CID 42523506
2-benzylsulfanyl-N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 42523506) has the molecular formula C19H17ClN2OS2 and a molecular weight of 388.95 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-benzylsulfanyl-N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 42523506 |
| Molecular Formula | C19H17ClN2OS2 |
| Molecular Weight | 388.95 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-benzylsulfanyl-N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)CSCc2ccccc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H17ClN2OS2/c1-2-10-22-16-9-8-15(20)11-17(16)25-19(22)21-18(23)13-24-12-14-6-4-3-5-7-14/h2-9,11H,1,10,12-13H2/b21-19- |
| InChIKey | AEXPLOURLIABDE-VZCXRCSSSA-N |
| XLogP | 4.90 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.95 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|