C21H22N2O5S2 — CID 25406946
ethyl 2-[2-[4-(benzenesulfonyl)butanoylimino]-1,3-benzothiazol-3-yl]acetate (PubChem CID 25406946) has the molecular formula C21H22N2O5S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is ethyl 2-[2-[4-(benzenesulfonyl)butanoylimino]-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[4-(benzenesulfonyl)butanoylimino]-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 25406946 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | ethyl 2-[2-[4-(benzenesulfonyl)butanoylimino]-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CCCS(=O)(=O)c2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C21H22N2O5S2/c1-2-28-20(25)15-23-17-11-6-7-12-18(17)29-21(23)22-19(24)13-8-14-30(26,27)16-9-4-3-5-10-16/h3-7,9-12H,2,8,13-15H2,1H3/b22-21- |
| InChIKey | JDJUUNOYPAOYSN-DQRAZIAOSA-N |
| XLogP | 2.95 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |