C21H22N2O4S — CID 40700414
ethyl 2-[2-[2-(4-ethoxyphenyl)acetyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 40700414) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is ethyl 2-[2-[2-(4-ethoxyphenyl)acetyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[2-(4-ethoxyphenyl)acetyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 40700414 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | ethyl 2-[2-[2-(4-ethoxyphenyl)acetyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)Cc2ccc(OCC)cc2)sc2ccccc21 |
| InChI | InChI=1S/C21H22N2O4S/c1-3-26-16-11-9-15(10-12-16)13-19(24)22-21-23(14-20(25)27-4-2)17-7-5-6-8-18(17)28-21/h5-12H,3-4,13-14H2,1-2H3/b22-21- |
| InChIKey | CDISYMVLGTWOSL-DQRAZIAOSA-N |
| XLogP | 3.33 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |