C18H24N2OS — CID 40997012
N-(6-butyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 40997012) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is N-(6-butyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | N-(6-butyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 40997012 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-(6-butyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCC)sc2cc(CCCC)ccc21 |
| InChI | InChI=1S/C18H24N2OS/c1-4-7-9-14-10-11-15-16(13-14)22-18(20(15)12-6-3)19-17(21)8-5-2/h6,10-11,13H,3-5,7-9,12H2,1-2H3/b19-18- |
| InChIKey | UWOKBAVCIDTVSO-HNENSFHCSA-N |
| XLogP | 4.46 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|