C17H10Cl2N2OS — CID 5067546
2,4-dichloro-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 5067546) has the molecular formula C17H10Cl2N2OS and a molecular weight of 361.25 g/mol. Its IUPAC name is 2,4-dichloro-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2,4-dichloro-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 5067546 |
| Molecular Formula | C17H10Cl2N2OS |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 2,4-dichloro-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(Cl)cc2Cl)sc2ccccc21 |
| InChI | InChI=1S/C17H10Cl2N2OS/c1-2-9-21-14-5-3-4-6-15(14)23-17(21)20-16(22)12-8-7-11(18)10-13(12)19/h1,3-8,10H,9H2/b20-17- |
| InChIKey | GOERFLDTBWXAKC-JZJYNLBNSA-N |
| XLogP | 4.38 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|