C16H14N4O2S2 — CID 43945815
N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylthiadiazole-5-carboxamide (PubChem CID 43945815) has the molecular formula C16H14N4O2S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 43945815 |
| Molecular Formula | C16H14N4O2S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylthiadiazole-5-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2snnc2C)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C16H14N4O2S2/c1-4-8-20-12-7-6-11(22-5-2)9-13(12)23-16(20)17-15(21)14-10(3)18-19-24-14/h1,6-7,9H,5,8H2,2-3H3/b17-16- |
| InChIKey | PNKASFGZDZBQCE-MSUUIHNZSA-N |
| XLogP | 2.64 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|