C15H12N4OS2 — CID 43945653
4-methyl-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiadiazole-5-carboxamide (PubChem CID 43945653) has the molecular formula C15H12N4OS2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-methyl-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 43945653 |
| Molecular Formula | C15H12N4OS2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 4-methyl-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiadiazole-5-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2snnc2C)sc2cc(C)ccc21 |
| InChI | InChI=1S/C15H12N4OS2/c1-4-7-19-11-6-5-9(2)8-12(11)21-15(19)16-14(20)13-10(3)17-18-22-13/h1,5-6,8H,7H2,2-3H3/b16-15- |
| InChIKey | XCHFDUNNJQNUFC-NXVVXOECSA-N |
| XLogP | 2.55 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|