C17H13BrN2O2S — CID 43945517
5-bromo-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide (PubChem CID 43945517) has the molecular formula C17H13BrN2O2S and a molecular weight of 389.27 g/mol. Its IUPAC name is 5-bromo-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide |
|---|---|
| PubChem CID | 43945517 |
| Molecular Formula | C17H13BrN2O2S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 5-bromo-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(Br)o2)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C17H13BrN2O2S/c1-3-9-20-12-6-5-11(4-2)10-14(12)23-17(20)19-16(21)13-7-8-15(18)22-13/h1,5-8,10H,4,9H2,2H3/b19-17- |
| InChIKey | MPYKGBDQFRWLBF-ZPHPHTNESA-N |
| XLogP | 3.99 |
| TPSA | 47.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|