C16H11BrN2O3S — CID 43945181
5-bromo-N-(6-methoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide (PubChem CID 43945181) has the molecular formula C16H11BrN2O3S and a molecular weight of 391.25 g/mol. Its IUPAC name is 5-bromo-N-(6-methoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(6-methoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide |
|---|---|
| PubChem CID | 43945181 |
| Molecular Formula | C16H11BrN2O3S |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 5-bromo-N-(6-methoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(Br)o2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C16H11BrN2O3S/c1-3-8-19-11-5-4-10(21-2)9-13(11)23-16(19)18-15(20)12-6-7-14(17)22-12/h1,4-7,9H,8H2,2H3/b18-16- |
| InChIKey | LQPQTKNKXOVZLS-VLGSPTGOSA-N |
| XLogP | 3.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|