C16H10FN3O4S2 — CID 16937923
(NZ)-4-fluoro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide (PubChem CID 16937923) has the molecular formula C16H10FN3O4S2 and a molecular weight of 391.41 g/mol. Its IUPAC name is (NZ)-4-fluoro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide.
| Compound Name | (NZ)-4-fluoro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 16937923 |
| Molecular Formula | C16H10FN3O4S2 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | (NZ)-4-fluoro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
| SMILES | C#CCn1/c(=N/S(=O)(=O)c2ccc(F)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H10FN3O4S2/c1-2-9-19-14-8-5-12(20(21)22)10-15(14)25-16(19)18-26(23,24)13-6-3-11(17)4-7-13/h1,3-8,10H,9H2/b18-16- |
| InChIKey | OFWJPOLQONXQNK-VLGSPTGOSA-N |
| XLogP | 2.67 |
| TPSA | 94.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|