C18H16N2O2S2 — CID 16937099
(NZ)-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide (PubChem CID 16937099) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (NZ)-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide.
| Compound Name | (NZ)-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 16937099 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (NZ)-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
| SMILES | C#CCn1/c(=N/S(=O)(=O)c2ccccc2)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C18H16N2O2S2/c1-3-12-20-16-11-10-14(4-2)13-17(16)23-18(20)19-24(21,22)15-8-6-5-7-9-15/h1,5-11,13H,4,12H2,2H3/b19-18- |
| InChIKey | DPEKHDPCTXDOCD-HNENSFHCSA-N |
| XLogP | 3.19 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|