C21H23N3O6S2 — CID 16851140
N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfonylbutanamide (PubChem CID 16851140) has the molecular formula C21H23N3O6S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 16851140 |
| Molecular Formula | C21H23N3O6S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfonylbutanamide |
| SMILES | COCCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccc(C)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C21H23N3O6S2/c1-15-5-8-17(9-6-15)32(28,29)13-3-4-20(25)22-21-23(11-12-30-2)18-14-16(24(26)27)7-10-19(18)31-21/h5-10,14H,3-4,11-13H2,1-2H3/b22-21- |
| InChIKey | WWGGAWPORDKZEO-DQRAZIAOSA-N |
| XLogP | 3.25 |
| TPSA | 120.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|