C14H13ClN2O3S2 — CID 2049819
N-(4-chloro-5-formyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)-4-methylbenzenesulfonamide (PubChem CID 2049819) has the molecular formula C14H13ClN2O3S2 and a molecular weight of 356.86 g/mol. Its IUPAC name is N-(4-chloro-5-formyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | N-(4-chloro-5-formyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2049819 |
| Molecular Formula | C14H13ClN2O3S2 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | N-(4-chloro-5-formyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)-4-methylbenzenesulfonamide |
| SMILES | C=CCn1c(Cl)c(C=O)sc1=NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H13ClN2O3S2/c1-3-8-17-13(15)12(9-18)21-14(17)16-22(19,20)11-6-4-10(2)5-7-11/h3-7,9H,1,8H2,2H3 |
| InChIKey | SQIJYGOATWEUDP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|