C14H15ClN4O4S3 — CID 2467515
ethyl N-[(4-chloro-3-prop-2-enyl-2-thiophen-2-ylsulfonylimino-1,3-thiazol-5-yl)methylideneamino]carbamate (PubChem CID 2467515) has the molecular formula C14H15ClN4O4S3 and a molecular weight of 434.95 g/mol. Its IUPAC name is ethyl N-[(4-chloro-3-prop-2-enyl-2-thiophen-2-ylsulfonylimino-1,3-thiazol-5-yl)methylideneamino]carbamate.
| Compound Name | ethyl N-[(4-chloro-3-prop-2-enyl-2-thiophen-2-ylsulfonylimino-1,3-thiazol-5-yl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 2467515 |
| Molecular Formula | C14H15ClN4O4S3 |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | ethyl N-[(4-chloro-3-prop-2-enyl-2-thiophen-2-ylsulfonylimino-1,3-thiazol-5-yl)methylideneamino]carbamate |
| SMILES | C=CCn1c(Cl)c(C=NNC(=O)OCC)sc1=NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H15ClN4O4S3/c1-3-7-19-12(15)10(9-16-17-14(20)23-4-2)25-13(19)18-26(21,22)11-6-5-8-24-11/h3,5-6,8-9H,1,4,7H2,2H3,(H,17,20) |
| InChIKey | KBLKRQRAURKSHO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|