C20H19N3O5S4 — CID 2328781
ethyl 3-prop-2-enyl-2-sulfanylidene-4-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 2328781) has the molecular formula C20H19N3O5S4 and a molecular weight of 509.66 g/mol. Its IUPAC name is ethyl 3-prop-2-enyl-2-sulfanylidene-4-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 3-prop-2-enyl-2-sulfanylidene-4-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 2328781 |
| Molecular Formula | C20H19N3O5S4 |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | ethyl 3-prop-2-enyl-2-sulfanylidene-4-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | C=CCn1c(NC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)c(C(=O)OCC)sc1=S |
| InChI | InChI=1S/C20H19N3O5S4/c1-3-11-23-17(16(31-20(23)29)19(25)28-4-2)21-18(24)13-7-9-14(10-8-13)22-32(26,27)15-6-5-12-30-15/h3,5-10,12,22H,1,4,11H2,2H3,(H,21,24) |
| InChIKey | PFOQPBCNQYOLKH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|