C19H16N2O6S2 — CID 56543247
methyl 2-hydroxy-3-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]benzoate (PubChem CID 56543247) has the molecular formula C19H16N2O6S2 and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 56543247 |
| Molecular Formula | C19H16N2O6S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | methyl 2-hydroxy-3-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)c1O |
| InChI | InChI=1S/C19H16N2O6S2/c1-27-19(24)14-4-2-5-15(17(14)22)20-18(23)12-7-9-13(10-8-12)21-29(25,26)16-6-3-11-28-16/h2-11,21-22H,1H3,(H,20,23) |
| InChIKey | HGTPCMMFAFPPEB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|