C17H15N3O4S2 — CID 113020656
methyl 2-[[5-(thiophen-2-ylsulfonylamino)-2-pyridinyl]amino]benzoate (PubChem CID 113020656) has the molecular formula C17H15N3O4S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is methyl 2-[[5-(thiophen-2-ylsulfonylamino)-2-pyridinyl]amino]benzoate.
| Compound Name | methyl 2-[[5-(thiophen-2-ylsulfonylamino)-2-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 113020656 |
| Molecular Formula | C17H15N3O4S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | methyl 2-[[5-(thiophen-2-ylsulfonylamino)-2-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ccc(NS(=O)(=O)c2cccs2)cn1 |
| InChI | InChI=1S/C17H15N3O4S2/c1-24-17(21)13-5-2-3-6-14(13)19-15-9-8-12(11-18-15)20-26(22,23)16-7-4-10-25-16/h2-11,20H,1H3,(H,18,19) |
| InChIKey | JFDSUPNYUCHHFV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |