C15H12FN3O2S2 — CID 113021347
N-[6-(3-fluoroanilino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113021347) has the molecular formula C15H12FN3O2S2 and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[6-(3-fluoroanilino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(3-fluoroanilino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113021347 |
| Molecular Formula | C15H12FN3O2S2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N-[6-(3-fluoroanilino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2cccc(F)c2)nc1)c1cccs1 |
| InChI | InChI=1S/C15H12FN3O2S2/c16-11-3-1-4-12(9-11)18-14-7-6-13(10-17-14)19-23(20,21)15-5-2-8-22-15/h1-10,19H,(H,17,18) |
| InChIKey | DKLKMCQHPVQHNL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |