C17H17N3O4S2 — CID 113020007
N-[6-(2,5-dimethoxyanilino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113020007) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[6-(2,5-dimethoxyanilino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(2,5-dimethoxyanilino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113020007 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-[6-(2,5-dimethoxyanilino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(OC)c(Nc2ccc(NS(=O)(=O)c3cccs3)cn2)c1 |
| InChI | InChI=1S/C17H17N3O4S2/c1-23-13-6-7-15(24-2)14(10-13)19-16-8-5-12(11-18-16)20-26(21,22)17-4-3-9-25-17/h3-11,20H,1-2H3,(H,18,19) |
| InChIKey | BOVYKDZNZUMNMR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |