C17H17N3O3S2 — CID 113027468
N-[5-[(4-methoxyphenyl)methylamino]-2-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113027468) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is N-[5-[(4-methoxyphenyl)methylamino]-2-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[5-[(4-methoxyphenyl)methylamino]-2-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113027468 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-[5-[(4-methoxyphenyl)methylamino]-2-pyridinyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(CNc2ccc(NS(=O)(=O)c3cccs3)nc2)cc1 |
| InChI | InChI=1S/C17H17N3O3S2/c1-23-15-7-4-13(5-8-15)11-18-14-6-9-16(19-12-14)20-25(21,22)17-3-2-10-24-17/h2-10,12,18H,11H2,1H3,(H,19,20) |
| InChIKey | HUHAVHWCJWYLRH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |