C16H15N3O3S2 — CID 113019463
N-[6-(3-methoxyanilino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113019463) has the molecular formula C16H15N3O3S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-[6-(3-methoxyanilino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(3-methoxyanilino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113019463 |
| Molecular Formula | C16H15N3O3S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | N-[6-(3-methoxyanilino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | COc1cccc(Nc2ccc(NS(=O)(=O)c3cccs3)cn2)c1 |
| InChI | InChI=1S/C16H15N3O3S2/c1-22-14-5-2-4-12(10-14)18-15-8-7-13(11-17-15)19-24(20,21)16-6-3-9-23-16/h2-11,19H,1H3,(H,17,18) |
| InChIKey | CRRSTRMPIVVBLG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |