C15H14N4O3S2 — CID 113048262
N-[6-(3-methoxyanilino)pyridazin-3-yl]thiophene-2-sulfonamide (PubChem CID 113048262) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is N-[6-(3-methoxyanilino)pyridazin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(3-methoxyanilino)pyridazin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113048262 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-[6-(3-methoxyanilino)pyridazin-3-yl]thiophene-2-sulfonamide |
| SMILES | COc1cccc(Nc2ccc(NS(=O)(=O)c3cccs3)nn2)c1 |
| InChI | InChI=1S/C15H14N4O3S2/c1-22-12-5-2-4-11(10-12)16-13-7-8-14(18-17-13)19-24(20,21)15-6-3-9-23-15/h2-10H,1H3,(H,16,17)(H,18,19) |
| InChIKey | YISAZCGSLOMRMG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |