C12H16N4O2S2 — CID 113044334
N-[6-(tert-butylamino)pyridazin-3-yl]thiophene-2-sulfonamide (PubChem CID 113044334) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[6-(tert-butylamino)pyridazin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(tert-butylamino)pyridazin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113044334 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[6-(tert-butylamino)pyridazin-3-yl]thiophene-2-sulfonamide |
| SMILES | CC(C)(C)Nc1ccc(NS(=O)(=O)c2cccs2)nn1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-12(2,3)13-9-6-7-10(15-14-9)16-20(17,18)11-5-4-8-19-11/h4-8H,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | AYZKVUFENINYPV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |