C10H10N2O2S2 — CID 893587
N-(6-methyl-2-pyridinyl)thiophene-2-sulfonamide (PubChem CID 893587) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)thiophene-2-sulfonamide.
| Compound Name | N-(6-methyl-2-pyridinyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 893587 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)thiophene-2-sulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cccs2)n1 |
| InChI | InChI=1S/C10H10N2O2S2/c1-8-4-2-5-9(11-8)12-16(13,14)10-6-3-7-15-10/h2-7H,1H3,(H,11,12) |
| InChIKey | UDLOLGWRKMDCTD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |