C14H10F2N4O2S2 — CID 113051603
N-[6-(2,6-difluoroanilino)pyridazin-3-yl]thiophene-2-sulfonamide (PubChem CID 113051603) has the molecular formula C14H10F2N4O2S2 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[6-(2,6-difluoroanilino)pyridazin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(2,6-difluoroanilino)pyridazin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113051603 |
| Molecular Formula | C14H10F2N4O2S2 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-[6-(2,6-difluoroanilino)pyridazin-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2c(F)cccc2F)nn1)c1cccs1 |
| InChI | InChI=1S/C14H10F2N4O2S2/c15-9-3-1-4-10(16)14(9)17-11-6-7-12(19-18-11)20-24(21,22)13-5-2-8-23-13/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | KMXJJGCZMSCERS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |