C18H20N4O2S2 — CID 113047104
N-[6-(2-tert-butylanilino)pyridazin-3-yl]thiophene-2-sulfonamide (PubChem CID 113047104) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is N-[6-(2-tert-butylanilino)pyridazin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(2-tert-butylanilino)pyridazin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113047104 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[6-(2-tert-butylanilino)pyridazin-3-yl]thiophene-2-sulfonamide |
| SMILES | CC(C)(C)c1ccccc1Nc1ccc(NS(=O)(=O)c2cccs2)nn1 |
| InChI | InChI=1S/C18H20N4O2S2/c1-18(2,3)13-7-4-5-8-14(13)19-15-10-11-16(21-20-15)22-26(23,24)17-9-6-12-25-17/h4-12H,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | WBLUJZMDEPHYKM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |