C15H13ClN4O2S2 — CID 113047421
N-[6-(2-chloroanilino)pyridazin-3-yl]-5-methylthiophene-2-sulfonamide (PubChem CID 113047421) has the molecular formula C15H13ClN4O2S2 and a molecular weight of 380.88 g/mol. Its IUPAC name is N-[6-(2-chloroanilino)pyridazin-3-yl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[6-(2-chloroanilino)pyridazin-3-yl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113047421 |
| Molecular Formula | C15H13ClN4O2S2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | N-[6-(2-chloroanilino)pyridazin-3-yl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Nc3ccccc3Cl)nn2)s1 |
| InChI | InChI=1S/C15H13ClN4O2S2/c1-10-6-9-15(23-10)24(21,22)20-14-8-7-13(18-19-14)17-12-5-3-2-4-11(12)16/h2-9H,1H3,(H,17,18)(H,19,20) |
| InChIKey | HSRXANUNRGPAKP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |