C12H12ClNO4S3 — CID 75449103
N-(3-chloro-2-methylsulfonylphenyl)-5-methylthiophene-2-sulfonamide (PubChem CID 75449103) has the molecular formula C12H12ClNO4S3 and a molecular weight of 365.89 g/mol. Its IUPAC name is N-(3-chloro-2-methylsulfonylphenyl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(3-chloro-2-methylsulfonylphenyl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 75449103 |
| Molecular Formula | C12H12ClNO4S3 |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | N-(3-chloro-2-methylsulfonylphenyl)-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(Cl)c2S(C)(=O)=O)s1 |
| InChI | InChI=1S/C12H12ClNO4S3/c1-8-6-7-11(19-8)21(17,18)14-10-5-3-4-9(13)12(10)20(2,15)16/h3-7,14H,1-2H3 |
| InChIKey | YJIPRPLOGNJUJX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |