C12H10ClNO4S2 — CID 18125828
N-(6-chloro-1,3-benzodioxol-5-yl)-5-methylthiophene-2-sulfonamide (PubChem CID 18125828) has the molecular formula C12H10ClNO4S2 and a molecular weight of 331.80 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzodioxol-5-yl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(6-chloro-1,3-benzodioxol-5-yl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 18125828 |
| Molecular Formula | C12H10ClNO4S2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | N-(6-chloro-1,3-benzodioxol-5-yl)-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc3c(cc2Cl)OCO3)s1 |
| InChI | InChI=1S/C12H10ClNO4S2/c1-7-2-3-12(19-7)20(15,16)14-9-5-11-10(4-8(9)13)17-6-18-11/h2-5,14H,6H2,1H3 |
| InChIKey | RDBWIDHYJJNNCM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |