C12H12N2O4S2 — CID 43550425
N-(6-amino-1,3-benzodioxol-5-yl)-5-methylthiophene-2-sulfonamide (PubChem CID 43550425) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43550425 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc3c(cc2N)OCO3)s1 |
| InChI | InChI=1S/C12H12N2O4S2/c1-7-2-3-12(19-7)20(15,16)14-9-5-11-10(4-8(9)13)17-6-18-11/h2-5,14H,6,13H2,1H3 |
| InChIKey | AYXBNUJQMVLBHK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|