C10H10N4O4S — CID 102690534
N-(6-amino-1,3-benzodioxol-5-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 102690534) has the molecular formula C10H10N4O4S and a molecular weight of 282.28 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102690534 |
| Molecular Formula | C10H10N4O4S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | Nc1cc2c(cc1NS(=O)(=O)c1ccn[nH]1)OCO2 |
| InChI | InChI=1S/C10H10N4O4S/c11-6-3-8-9(18-5-17-8)4-7(6)14-19(15,16)10-1-2-12-13-10/h1-4,14H,5,11H2,(H,12,13) |
| InChIKey | MMBUOUCFYJDUFV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|