C9H6F3N3O2S — CID 102692960
N-(2,3,5-trifluorophenyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692960) has the molecular formula C9H6F3N3O2S and a molecular weight of 277.23 g/mol. Its IUPAC name is N-(2,3,5-trifluorophenyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2,3,5-trifluorophenyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692960 |
| Molecular Formula | C9H6F3N3O2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | N-(2,3,5-trifluorophenyl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)cc(F)c1F)c1ccn[nH]1 |
| InChI | InChI=1S/C9H6F3N3O2S/c10-5-3-6(11)9(12)7(4-5)15-18(16,17)8-1-2-13-14-8/h1-4,15H,(H,13,14) |
| InChIKey | YNSTVEGAIQIMOG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|