C10H12N4O2S — CID 102693540
N-[4-(methylamino)phenyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102693540) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is N-[4-(methylamino)phenyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[4-(methylamino)phenyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693540 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-[4-(methylamino)phenyl]-1H-pyrazole-5-sulfonamide |
| SMILES | CNc1ccc(NS(=O)(=O)c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C10H12N4O2S/c1-11-8-2-4-9(5-3-8)14-17(15,16)10-6-7-12-13-10/h2-7,11,14H,1H3,(H,12,13) |
| InChIKey | SGRSGRKNYXMJCT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |