C13H17N3O2S — CID 102691460
N-(4-tert-butylphenyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102691460) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(4-tert-butylphenyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691460 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(4-tert-butylphenyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CC(C)(C)c1ccc(NS(=O)(=O)c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C13H17N3O2S/c1-13(2,3)10-4-6-11(7-5-10)16-19(17,18)12-8-9-14-15-12/h4-9,16H,1-3H3,(H,14,15) |
| InChIKey | SUAPBYGCJLYNFG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |